C29H26FN3O6S — CID 3924372
4-[[2-(4-ethoxycarbonylphenyl)imino-3-[2-(4-fluorophenyl)ethyl]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid (PubChem CID 3924372) has the molecular formula C29H26FN3O6S and a molecular weight of 563.61 g/mol. Its IUPAC name is 4-[[2-(4-ethoxycarbonylphenyl)imino-3-[2-(4-fluorophenyl)ethyl]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[2-(4-ethoxycarbonylphenyl)imino-3-[2-(4-fluorophenyl)ethyl]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 3924372 |
| Molecular Formula | C29H26FN3O6S |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 4-[[2-(4-ethoxycarbonylphenyl)imino-3-[2-(4-fluorophenyl)ethyl]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
| SMILES | CCOC(=O)c1ccc(/N=C2\SC(C(=O)Nc3ccc(C(=O)O)cc3)CC(=O)N2CCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H26FN3O6S/c1-2-39-28(38)20-7-13-23(14-8-20)32-29-33(16-15-18-3-9-21(30)10-4-18)25(34)17-24(40-29)26(35)31-22-11-5-19(6-12-22)27(36)37/h3-14,24H,2,15-17H2,1H3,(H,31,35)(H,36,37)/b32-29- |
| InChIKey | CZQJSQGPOQJXOZ-OVXWJCGASA-N |
| XLogP | 4.90 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|