C26H23ClFN3O3S — CID 3400044
3-[2-(4-chlorophenyl)ethyl]-2-(4-fluorophenyl)imino-N-(4-methoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 3400044) has the molecular formula C26H23ClFN3O3S and a molecular weight of 512.01 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)ethyl]-2-(4-fluorophenyl)imino-N-(4-methoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 3-[2-(4-chlorophenyl)ethyl]-2-(4-fluorophenyl)imino-N-(4-methoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3400044 |
| Molecular Formula | C26H23ClFN3O3S |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 3-[2-(4-chlorophenyl)ethyl]-2-(4-fluorophenyl)imino-N-(4-methoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CC(=O)N(CCc3ccc(Cl)cc3)/C(=N/c3ccc(F)cc3)S2)cc1 |
| InChI | InChI=1S/C26H23ClFN3O3S/c1-34-22-12-10-20(11-13-22)29-25(33)23-16-24(32)31(15-14-17-2-4-18(27)5-3-17)26(35-23)30-21-8-6-19(28)7-9-21/h2-13,23H,14-16H2,1H3,(H,29,33)/b30-26- |
| InChIKey | OMNOEODFFURHBH-BXVZCJGGSA-N |
| XLogP | 5.69 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|