C28H26ClF2N3O5S — CID 3993155
N-[4-[chloro(difluoro)methoxy]phenyl]-3-[2-(4-methoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 3993155) has the molecular formula C28H26ClF2N3O5S and a molecular weight of 590.05 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-3-[2-(4-methoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-3-[2-(4-methoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3993155 |
| Molecular Formula | C28H26ClF2N3O5S |
| Molecular Weight | 590.05 g/mol |
| Exact Mass | 589.12 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-3-[2-(4-methoxyphenyl)ethyl]-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(CCN2C(=O)CC(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)S/C2=N\c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H26ClF2N3O5S/c1-37-21-9-3-18(4-10-21)15-16-34-25(35)17-24(40-27(34)33-20-5-11-22(38-2)12-6-20)26(36)32-19-7-13-23(14-8-19)39-28(29,30)31/h3-14,24H,15-17H2,1-2H3,(H,32,36)/b33-27- |
| InChIKey | YKEDBCPGGOPGJS-KGGMANCPSA-N |
| XLogP | 6.07 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.05 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|