C27H24ClF2N3O4S — CID 3968297
2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(4-methoxyphenyl)-4-oxo-3-(2-phenylethyl)-1,3-thiazinane-6-carboxamide (PubChem CID 3968297) has the molecular formula C27H24ClF2N3O4S and a molecular weight of 560.02 g/mol. Its IUPAC name is 2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(4-methoxyphenyl)-4-oxo-3-(2-phenylethyl)-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(4-methoxyphenyl)-4-oxo-3-(2-phenylethyl)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3968297 |
| Molecular Formula | C27H24ClF2N3O4S |
| Molecular Weight | 560.02 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | 2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(4-methoxyphenyl)-4-oxo-3-(2-phenylethyl)-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CC(=O)N(CCc3ccccc3)/C(=N/c3ccc(OC(F)(F)Cl)cc3)S2)cc1 |
| InChI | InChI=1S/C27H24ClF2N3O4S/c1-36-21-11-7-19(8-12-21)31-25(35)23-17-24(34)33(16-15-18-5-3-2-4-6-18)26(38-23)32-20-9-13-22(14-10-20)37-27(28,29)30/h2-14,23H,15-17H2,1H3,(H,31,35)/b32-26- |
| InChIKey | BHIVQWMVVKHTBD-FSRJSHLRSA-N |
| XLogP | 6.07 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.02 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|