C21H18ClF2N3O5S — CID 40971447
4-[[(6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-3-ethyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid (PubChem CID 40971447) has the molecular formula C21H18ClF2N3O5S and a molecular weight of 497.91 g/mol. Its IUPAC name is 4-[[(6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-3-ethyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[(6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-3-ethyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 40971447 |
| Molecular Formula | C21H18ClF2N3O5S |
| Molecular Weight | 497.91 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 4-[[(6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-3-ethyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
| SMILES | CCN1C(=O)C[C@@H](C(=O)Nc2ccc(C(=O)O)cc2)S/C1=N\c1ccc(OC(F)(F)Cl)cc1 |
| InChI | InChI=1S/C21H18ClF2N3O5S/c1-2-27-17(28)11-16(18(29)25-13-5-3-12(4-6-13)19(30)31)33-20(27)26-14-7-9-15(10-8-14)32-21(22,23)24/h3-10,16H,2,11H2,1H3,(H,25,29)(H,30,31)/b26-20-/t16-/m0/s1 |
| InChIKey | KKJBHEDIGYJOLB-WOYCXUPWSA-N |
| XLogP | 4.53 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.91 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|