C20H18ClN3O4S — CID 3140631
4-[[2-(4-chlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid (PubChem CID 3140631) has the molecular formula C20H18ClN3O4S and a molecular weight of 431.90 g/mol. Its IUPAC name is 4-[[2-(4-chlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[2-(4-chlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 3140631 |
| Molecular Formula | C20H18ClN3O4S |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 4-[[2-(4-chlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
| SMILES | CCN1C(=O)CC(C(=O)Nc2ccc(C(=O)O)cc2)S/C1=N\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClN3O4S/c1-2-24-17(25)11-16(29-20(24)23-15-9-5-13(21)6-10-15)18(26)22-14-7-3-12(4-8-14)19(27)28/h3-10,16H,2,11H2,1H3,(H,22,26)(H,27,28)/b23-20- |
| InChIKey | YJSXIDFFNFNFGS-ATJXCDBQSA-N |
| XLogP | 4.02 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|