C26H21Cl2N3O4S — CID 4084312
methyl 4-[[2-(4-chlorophenyl)imino-3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate (PubChem CID 4084312) has the molecular formula C26H21Cl2N3O4S and a molecular weight of 542.44 g/mol. Its IUPAC name is methyl 4-[[2-(4-chlorophenyl)imino-3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(4-chlorophenyl)imino-3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 4084312 |
| Molecular Formula | C26H21Cl2N3O4S |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 541.06 |
| IUPAC Name | methyl 4-[[2-(4-chlorophenyl)imino-3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2CC(=O)N(Cc3ccc(Cl)cc3)/C(=N/c3ccc(Cl)cc3)S2)cc1 |
| InChI | InChI=1S/C26H21Cl2N3O4S/c1-35-25(34)17-4-10-20(11-5-17)29-24(33)22-14-23(32)31(15-16-2-6-18(27)7-3-16)26(36-22)30-21-12-8-19(28)9-13-21/h2-13,22H,14-15H2,1H3,(H,29,33)/b30-26- |
| InChIKey | QKVLNGRNCQMPHL-BXVZCJGGSA-N |
| XLogP | 5.94 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|