C21H19Cl2N3O4S — CID 5113036
methyl 4-[[6-[(3,5-dichlorophenyl)carbamoyl]-3-ethyl-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate (PubChem CID 5113036) has the molecular formula C21H19Cl2N3O4S and a molecular weight of 480.37 g/mol. Its IUPAC name is methyl 4-[[6-[(3,5-dichlorophenyl)carbamoyl]-3-ethyl-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate.
| Compound Name | methyl 4-[[6-[(3,5-dichlorophenyl)carbamoyl]-3-ethyl-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 5113036 |
| Molecular Formula | C21H19Cl2N3O4S |
| Molecular Weight | 480.37 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | methyl 4-[[6-[(3,5-dichlorophenyl)carbamoyl]-3-ethyl-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate |
| SMILES | CCN1C(=O)CC(C(=O)Nc2cc(Cl)cc(Cl)c2)S/C1=N\c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C21H19Cl2N3O4S/c1-3-26-18(27)11-17(19(28)24-16-9-13(22)8-14(23)10-16)31-21(26)25-15-6-4-12(5-7-15)20(29)30-2/h4-10,17H,3,11H2,1-2H3,(H,24,28)/b25-21- |
| InChIKey | SMQJAHSWCDVSLR-DAFNUICNSA-N |
| XLogP | 4.76 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|