C22H20ClF2N3O5S — CID 1039387
methyl 4-[[(6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-3-ethyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate (PubChem CID 1039387) has the molecular formula C22H20ClF2N3O5S and a molecular weight of 511.93 g/mol. Its IUPAC name is methyl 4-[[(6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-3-ethyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[(6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-3-ethyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 1039387 |
| Molecular Formula | C22H20ClF2N3O5S |
| Molecular Weight | 511.93 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | methyl 4-[[(6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-3-ethyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate |
| SMILES | CCN1C(=O)C[C@@H](C(=O)Nc2ccc(C(=O)OC)cc2)S/C1=N\c1ccc(OC(F)(F)Cl)cc1 |
| InChI | InChI=1S/C22H20ClF2N3O5S/c1-3-28-18(29)12-17(19(30)26-14-6-4-13(5-7-14)20(31)32-2)34-21(28)27-15-8-10-16(11-9-15)33-22(23,24)25/h4-11,17H,3,12H2,1-2H3,(H,26,30)/b27-21-/t17-/m0/s1 |
| InChIKey | DRMZSSVRQQCWTF-IDICYNCBSA-N |
| XLogP | 4.62 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.93 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|