C20H16Cl3F2N3O3S — CID 92905527
(6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(3,5-dichlorophenyl)-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 92905527) has the molecular formula C20H16Cl3F2N3O3S and a molecular weight of 522.79 g/mol. Its IUPAC name is (6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(3,5-dichlorophenyl)-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(3,5-dichlorophenyl)-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 92905527 |
| Molecular Formula | C20H16Cl3F2N3O3S |
| Molecular Weight | 522.79 g/mol |
| Exact Mass | 520.99 |
| IUPAC Name | (6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(3,5-dichlorophenyl)-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCN1C(=O)C[C@@H](C(=O)Nc2cc(Cl)cc(Cl)c2)S/C1=N\c1ccc(OC(F)(F)Cl)cc1 |
| InChI | InChI=1S/C20H16Cl3F2N3O3S/c1-2-28-17(29)10-16(18(30)26-14-8-11(21)7-12(22)9-14)32-19(28)27-13-3-5-15(6-4-13)31-20(23,24)25/h3-9,16H,2,10H2,1H3,(H,26,30)/b27-19-/t16-/m0/s1 |
| InChIKey | BGDBXUBUMLJZRC-FSPSLNBNSA-N |
| XLogP | 6.14 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.79 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|