C20H15Cl3F3N3O2S — CID 3514507
2-[4-chloro-3-(trifluoromethyl)phenyl]imino-N-(3,5-dichlorophenyl)-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 3514507) has the molecular formula C20H15Cl3F3N3O2S and a molecular weight of 524.78 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-N-(3,5-dichlorophenyl)-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-N-(3,5-dichlorophenyl)-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3514507 |
| Molecular Formula | C20H15Cl3F3N3O2S |
| Molecular Weight | 524.78 g/mol |
| Exact Mass | 522.99 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-N-(3,5-dichlorophenyl)-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCN1C(=O)CC(C(=O)Nc2cc(Cl)cc(Cl)c2)S/C1=N\c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H15Cl3F3N3O2S/c1-2-29-17(30)9-16(18(31)27-13-6-10(21)5-11(22)7-13)32-19(29)28-12-3-4-15(23)14(8-12)20(24,25)26/h3-8,16H,2,9H2,1H3,(H,27,31)/b28-19- |
| InChIKey | NLKOZLBKCUTODJ-USHMODERSA-N |
| XLogP | 6.65 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.78 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|