C20H17Cl2N3O4S — CID 41244452
4-[[(6S)-2-(3,5-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid (PubChem CID 41244452) has the molecular formula C20H17Cl2N3O4S and a molecular weight of 466.35 g/mol. Its IUPAC name is 4-[[(6S)-2-(3,5-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[(6S)-2-(3,5-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 41244452 |
| Molecular Formula | C20H17Cl2N3O4S |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | 4-[[(6S)-2-(3,5-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
| SMILES | CCN1C(=O)C[C@@H](C(=O)Nc2ccc(C(=O)O)cc2)S/C1=N\c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H17Cl2N3O4S/c1-2-25-17(26)10-16(18(27)23-14-5-3-11(4-6-14)19(28)29)30-20(25)24-15-8-12(21)7-13(22)9-15/h3-9,16H,2,10H2,1H3,(H,23,27)(H,28,29)/b24-20-/t16-/m0/s1 |
| InChIKey | FIXWZVSFEMXXCI-GFDWPABASA-N |
| XLogP | 4.67 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|