C19H16Cl3N3O2S — CID 3326916
N-(2-chlorophenyl)-2-(3,5-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 3326916) has the molecular formula C19H16Cl3N3O2S and a molecular weight of 456.78 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(3,5-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(2-chlorophenyl)-2-(3,5-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3326916 |
| Molecular Formula | C19H16Cl3N3O2S |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | N-(2-chlorophenyl)-2-(3,5-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCN1C(=O)CC(C(=O)Nc2ccccc2Cl)S/C1=N\c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H16Cl3N3O2S/c1-2-25-17(26)10-16(18(27)24-15-6-4-3-5-14(15)22)28-19(25)23-13-8-11(20)7-12(21)9-13/h3-9,16H,2,10H2,1H3,(H,24,27)/b23-19- |
| InChIKey | IGHOGXWZLHWPMF-NMWGTECJSA-N |
| XLogP | 5.63 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|