C22H24ClN3O2S — CID 4161921
2-(3-chloro-4-methylphenyl)imino-N-(2,4-dimethylphenyl)-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 4161921) has the molecular formula C22H24ClN3O2S and a molecular weight of 429.97 g/mol. Its IUPAC name is 2-(3-chloro-4-methylphenyl)imino-N-(2,4-dimethylphenyl)-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(3-chloro-4-methylphenyl)imino-N-(2,4-dimethylphenyl)-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4161921 |
| Molecular Formula | C22H24ClN3O2S |
| Molecular Weight | 429.97 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 2-(3-chloro-4-methylphenyl)imino-N-(2,4-dimethylphenyl)-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCN1C(=O)CC(C(=O)Nc2ccc(C)cc2C)S/C1=N\c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C22H24ClN3O2S/c1-5-26-20(27)12-19(21(28)25-18-9-6-13(2)10-15(18)4)29-22(26)24-16-8-7-14(3)17(23)11-16/h6-11,19H,5,12H2,1-4H3,(H,25,28)/b24-22- |
| InChIKey | OMRRAHKGRNEXRB-GYHWCHFESA-N |
| XLogP | 5.25 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.97 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|