C20H18Cl3N3O2S — CID 5140673
N-(3-chloro-4-methylphenyl)-2-(3,4-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 5140673) has the molecular formula C20H18Cl3N3O2S and a molecular weight of 470.81 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-(3,4-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-(3,4-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 5140673 |
| Molecular Formula | C20H18Cl3N3O2S |
| Molecular Weight | 470.81 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-(3,4-dichlorophenyl)imino-3-ethyl-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCN1C(=O)CC(C(=O)Nc2ccc(C)c(Cl)c2)S/C1=N\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H18Cl3N3O2S/c1-3-26-18(27)10-17(19(28)24-12-5-4-11(2)15(22)8-12)29-20(26)25-13-6-7-14(21)16(23)9-13/h4-9,17H,3,10H2,1-2H3,(H,24,28)/b25-20- |
| InChIKey | CKXOKRXMHTXMEE-QQTULTPQSA-N |
| XLogP | 5.94 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.81 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|