C25H29Cl2N3O3S — CID 3140609
2-(3,4-dichlorophenyl)imino-3-ethyl-N-(4-hexoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 3140609) has the molecular formula C25H29Cl2N3O3S and a molecular weight of 522.50 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)imino-3-ethyl-N-(4-hexoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)imino-3-ethyl-N-(4-hexoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3140609 |
| Molecular Formula | C25H29Cl2N3O3S |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 2-(3,4-dichlorophenyl)imino-3-ethyl-N-(4-hexoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCCCCCOc1ccc(NC(=O)C2CC(=O)N(CC)/C(=N/c3ccc(Cl)c(Cl)c3)S2)cc1 |
| InChI | InChI=1S/C25H29Cl2N3O3S/c1-3-5-6-7-14-33-19-11-8-17(9-12-19)28-24(32)22-16-23(31)30(4-2)25(34-22)29-18-10-13-20(26)21(27)15-18/h8-13,15,22H,3-7,14,16H2,1-2H3,(H,28,32)/b29-25- |
| InChIKey | KHCNMIHAPJBKOU-GNVQSUKOSA-N |
| XLogP | 6.93 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|