C27H34ClN3O3S — CID 4052639
2-(3-chlorophenyl)imino-3-heptyl-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide (PubChem CID 4052639) has the molecular formula C27H34ClN3O3S and a molecular weight of 516.11 g/mol. Its IUPAC name is 2-(3-chlorophenyl)imino-3-heptyl-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(3-chlorophenyl)imino-3-heptyl-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4052639 |
| Molecular Formula | C27H34ClN3O3S |
| Molecular Weight | 516.11 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 2-(3-chlorophenyl)imino-3-heptyl-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide |
| SMILES | CCCCCCCN1C(=O)CC(C(=O)Nc2ccc(OCCC)cc2)S/C1=N\c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H34ClN3O3S/c1-3-5-6-7-8-16-31-25(32)19-24(35-27(31)30-22-11-9-10-20(28)18-22)26(33)29-21-12-14-23(15-13-21)34-17-4-2/h9-15,18,24H,3-8,16-17,19H2,1-2H3,(H,29,33)/b30-27- |
| InChIKey | FOTZMNCPDNRCCM-IKPAITLHSA-N |
| XLogP | 7.06 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.11 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|