C25H30FN3O3S — CID 40617769
(6R)-3-ethyl-2-(3-fluorophenyl)imino-N-(4-hexoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 40617769) has the molecular formula C25H30FN3O3S and a molecular weight of 471.60 g/mol. Its IUPAC name is (6R)-3-ethyl-2-(3-fluorophenyl)imino-N-(4-hexoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (6R)-3-ethyl-2-(3-fluorophenyl)imino-N-(4-hexoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 40617769 |
| Molecular Formula | C25H30FN3O3S |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | (6R)-3-ethyl-2-(3-fluorophenyl)imino-N-(4-hexoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCCCCCOc1ccc(NC(=O)[C@H]2CC(=O)N(CC)/C(=N/c3cccc(F)c3)S2)cc1 |
| InChI | InChI=1S/C25H30FN3O3S/c1-3-5-6-7-15-32-21-13-11-19(12-14-21)27-24(31)22-17-23(30)29(4-2)25(33-22)28-20-10-8-9-18(26)16-20/h8-14,16,22H,3-7,15,17H2,1-2H3,(H,27,31)/b28-25-/t22-/m1/s1 |
| InChIKey | ZXMONIZJCBJNBI-AOKXBXCXSA-N |
| XLogP | 5.76 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|