C25H28F3N3O3S — CID 4125017
N-(4-hexoxyphenyl)-3-methyl-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide (PubChem CID 4125017) has the molecular formula C25H28F3N3O3S and a molecular weight of 507.58 g/mol. Its IUPAC name is N-(4-hexoxyphenyl)-3-methyl-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(4-hexoxyphenyl)-3-methyl-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4125017 |
| Molecular Formula | C25H28F3N3O3S |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | N-(4-hexoxyphenyl)-3-methyl-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide |
| SMILES | CCCCCCOc1ccc(NC(=O)C2CC(=O)N(C)/C(=N/c3cccc(C(F)(F)F)c3)S2)cc1 |
| InChI | InChI=1S/C25H28F3N3O3S/c1-3-4-5-6-14-34-20-12-10-18(11-13-20)29-23(33)21-16-22(32)31(2)24(35-21)30-19-9-7-8-17(15-19)25(26,27)28/h7-13,15,21H,3-6,14,16H2,1-2H3,(H,29,33)/b30-24- |
| InChIKey | OXHOQVGBJOFSRI-KRUMMXJUSA-N |
| XLogP | 6.25 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|