C21H18F3N3O4S — CID 25322788
methyl 4-[[(6R)-3-methyl-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carbonyl]amino]benzoate (PubChem CID 25322788) has the molecular formula C21H18F3N3O4S and a molecular weight of 465.45 g/mol. Its IUPAC name is methyl 4-[[(6R)-3-methyl-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[(6R)-3-methyl-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 25322788 |
| Molecular Formula | C21H18F3N3O4S |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | methyl 4-[[(6R)-3-methyl-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)[C@H]2CC(=O)N(C)/C(=N/c3cccc(C(F)(F)F)c3)S2)cc1 |
| InChI | InChI=1S/C21H18F3N3O4S/c1-27-17(28)11-16(18(29)25-14-8-6-12(7-9-14)19(30)31-2)32-20(27)26-15-5-3-4-13(10-15)21(22,23)24/h3-10,16H,11H2,1-2H3,(H,25,29)/b26-20-/t16-/m1/s1 |
| InChIKey | NTZIYLUOAWIBOW-DEZIIBQTSA-N |
| XLogP | 4.08 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|