C29H26F3N3O4S — CID 4101553
methyl 4-[[4-oxo-3-(3-phenylpropyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carbonyl]amino]benzoate (PubChem CID 4101553) has the molecular formula C29H26F3N3O4S and a molecular weight of 569.61 g/mol. Its IUPAC name is methyl 4-[[4-oxo-3-(3-phenylpropyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[4-oxo-3-(3-phenylpropyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 4101553 |
| Molecular Formula | C29H26F3N3O4S |
| Molecular Weight | 569.61 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | methyl 4-[[4-oxo-3-(3-phenylpropyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2CC(=O)N(CCCc3ccccc3)/C(=N/c3cccc(C(F)(F)F)c3)S2)cc1 |
| InChI | InChI=1S/C29H26F3N3O4S/c1-39-27(38)20-12-14-22(15-13-20)33-26(37)24-18-25(36)35(16-6-9-19-7-3-2-4-8-19)28(40-24)34-23-11-5-10-21(17-23)29(30,31)32/h2-5,7-8,10-15,17,24H,6,9,16,18H2,1H3,(H,33,37)/b34-28- |
| InChIKey | SVPFDBAFKVABGW-BFYITVNDSA-N |
| XLogP | 6.09 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.61 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|