C25H19F4N3O2S — CID 5206652
3-benzyl-N-(4-fluorophenyl)-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide (PubChem CID 5206652) has the molecular formula C25H19F4N3O2S and a molecular weight of 501.51 g/mol. Its IUPAC name is 3-benzyl-N-(4-fluorophenyl)-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide.
| Compound Name | 3-benzyl-N-(4-fluorophenyl)-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 5206652 |
| Molecular Formula | C25H19F4N3O2S |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 3-benzyl-N-(4-fluorophenyl)-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)C1CC(=O)N(Cc2ccccc2)/C(=N/c2cccc(C(F)(F)F)c2)S1 |
| InChI | InChI=1S/C25H19F4N3O2S/c26-18-9-11-19(12-10-18)30-23(34)21-14-22(33)32(15-16-5-2-1-3-6-16)24(35-21)31-20-8-4-7-17(13-20)25(27,28)29/h1-13,21H,14-15H2,(H,30,34)/b31-24- |
| InChIKey | OZXDXAUAGCFGHB-QLTSDVKISA-N |
| XLogP | 6.01 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|