C20H17F4N3O2S — CID 3140640
3-ethyl-N-(4-fluorophenyl)-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide (PubChem CID 3140640) has the molecular formula C20H17F4N3O2S and a molecular weight of 439.43 g/mol. Its IUPAC name is 3-ethyl-N-(4-fluorophenyl)-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide.
| Compound Name | 3-ethyl-N-(4-fluorophenyl)-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3140640 |
| Molecular Formula | C20H17F4N3O2S |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 3-ethyl-N-(4-fluorophenyl)-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide |
| SMILES | CCN1C(=O)CC(C(=O)Nc2ccc(F)cc2)S/C1=N\c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17F4N3O2S/c1-2-27-17(28)11-16(18(29)25-14-8-6-13(21)7-9-14)30-19(27)26-15-5-3-4-12(10-15)20(22,23)24/h3-10,16H,2,11H2,1H3,(H,25,29)/b26-19- |
| InChIKey | SJTBBFFXPNZHJD-XHPQRKPJSA-N |
| XLogP | 4.82 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|