C28H25ClF3N3O3S — CID 5083394
3-[(4-chlorophenyl)methyl]-4-oxo-N-(4-propoxyphenyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide (PubChem CID 5083394) has the molecular formula C28H25ClF3N3O3S and a molecular weight of 576.04 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-4-oxo-N-(4-propoxyphenyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide.
| Compound Name | 3-[(4-chlorophenyl)methyl]-4-oxo-N-(4-propoxyphenyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 5083394 |
| Molecular Formula | C28H25ClF3N3O3S |
| Molecular Weight | 576.04 g/mol |
| Exact Mass | 575.13 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-4-oxo-N-(4-propoxyphenyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)C2CC(=O)N(Cc3ccc(Cl)cc3)/C(=N/c3cccc(C(F)(F)F)c3)S2)cc1 |
| InChI | InChI=1S/C28H25ClF3N3O3S/c1-2-14-38-23-12-10-21(11-13-23)33-26(37)24-16-25(36)35(17-18-6-8-20(29)9-7-18)27(39-24)34-22-5-3-4-19(15-22)28(30,31)32/h3-13,15,24H,2,14,16-17H2,1H3,(H,33,37)/b34-27- |
| InChIKey | RCNITIGTBLVEKL-YLHCSOALSA-N |
| XLogP | 7.31 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.04 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|