C31H32ClN3O5S — CID 3955921
ethyl 4-[[6-[(4-butoxyphenyl)carbamoyl]-3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate (PubChem CID 3955921) has the molecular formula C31H32ClN3O5S and a molecular weight of 594.13 g/mol. Its IUPAC name is ethyl 4-[[6-[(4-butoxyphenyl)carbamoyl]-3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[6-[(4-butoxyphenyl)carbamoyl]-3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 3955921 |
| Molecular Formula | C31H32ClN3O5S |
| Molecular Weight | 594.13 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | ethyl 4-[[6-[(4-butoxyphenyl)carbamoyl]-3-[(4-chlorophenyl)methyl]-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate |
| SMILES | CCCCOc1ccc(NC(=O)C2CC(=O)N(Cc3ccc(Cl)cc3)/C(=N/c3ccc(C(=O)OCC)cc3)S2)cc1 |
| InChI | InChI=1S/C31H32ClN3O5S/c1-3-5-18-40-26-16-14-24(15-17-26)33-29(37)27-19-28(36)35(20-21-6-10-23(32)11-7-21)31(41-27)34-25-12-8-22(9-13-25)30(38)39-4-2/h6-17,27H,3-5,18-20H2,1-2H3,(H,33,37)/b34-31- |
| InChIKey | LBERJZYQBWTTRK-NMSHJFGGSA-N |
| XLogP | 6.86 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.13 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|