C24H25Cl2N3O4S — CID 25304889
ethyl 4-[[(6R)-3-butyl-2-(3,5-dichlorophenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate (PubChem CID 25304889) has the molecular formula C24H25Cl2N3O4S and a molecular weight of 522.45 g/mol. Its IUPAC name is ethyl 4-[[(6R)-3-butyl-2-(3,5-dichlorophenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[(6R)-3-butyl-2-(3,5-dichlorophenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 25304889 |
| Molecular Formula | C24H25Cl2N3O4S |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | ethyl 4-[[(6R)-3-butyl-2-(3,5-dichlorophenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate |
| SMILES | CCCCN1C(=O)C[C@H](C(=O)Nc2ccc(C(=O)OCC)cc2)S/C1=N\c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C24H25Cl2N3O4S/c1-3-5-10-29-21(30)14-20(34-24(29)28-19-12-16(25)11-17(26)13-19)22(31)27-18-8-6-15(7-9-18)23(32)33-4-2/h6-9,11-13,20H,3-5,10,14H2,1-2H3,(H,27,31)/b28-24-/t20-/m1/s1 |
| InChIKey | ZKPKHULUBMSMCO-UVVVPPGDSA-N |
| XLogP | 5.93 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|