C22H22ClN3O4S — CID 3141811
ethyl 4-[[3-[(4-chlorophenyl)methyl]-6-(methylcarbamoyl)-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate (PubChem CID 3141811) has the molecular formula C22H22ClN3O4S and a molecular weight of 459.96 g/mol. Its IUPAC name is ethyl 4-[[3-[(4-chlorophenyl)methyl]-6-(methylcarbamoyl)-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[3-[(4-chlorophenyl)methyl]-6-(methylcarbamoyl)-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 3141811 |
| Molecular Formula | C22H22ClN3O4S |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | ethyl 4-[[3-[(4-chlorophenyl)methyl]-6-(methylcarbamoyl)-4-oxo-1,3-thiazinan-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2\SC(C(=O)NC)CC(=O)N2Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H22ClN3O4S/c1-3-30-21(29)15-6-10-17(11-7-15)25-22-26(13-14-4-8-16(23)9-5-14)19(27)12-18(31-22)20(28)24-2/h4-11,18H,3,12-13H2,1-2H3,(H,24,28)/b25-22- |
| InChIKey | UQGRSVBLTFHMSF-LVWGJNHUSA-N |
| XLogP | 3.78 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|