C19H15BrF3N3O2S — CID 3619455
N-(4-bromophenyl)-3-methyl-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide (PubChem CID 3619455) has the molecular formula C19H15BrF3N3O2S and a molecular weight of 486.31 g/mol. Its IUPAC name is N-(4-bromophenyl)-3-methyl-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(4-bromophenyl)-3-methyl-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3619455 |
| Molecular Formula | C19H15BrF3N3O2S |
| Molecular Weight | 486.31 g/mol |
| Exact Mass | 485.00 |
| IUPAC Name | N-(4-bromophenyl)-3-methyl-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide |
| SMILES | CN1C(=O)CC(C(=O)Nc2ccc(Br)cc2)S/C1=N\c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15BrF3N3O2S/c1-26-16(27)10-15(17(28)24-13-7-5-12(20)6-8-13)29-18(26)25-14-4-2-3-11(9-14)19(21,22)23/h2-9,15H,10H2,1H3,(H,24,28)/b25-18- |
| InChIKey | GKTALWZXQZGDMV-BWAHOGKJSA-N |
| XLogP | 5.06 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.31 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|