C13H14BrN3O2S — CID 7025824
(6S)-N-(4-bromophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 7025824) has the molecular formula C13H14BrN3O2S and a molecular weight of 356.25 g/mol. Its IUPAC name is (6S)-N-(4-bromophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (6S)-N-(4-bromophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 7025824 |
| Molecular Formula | C13H14BrN3O2S |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | (6S)-N-(4-bromophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | C/N=C1\S[C@H](C(=O)Nc2ccc(Br)cc2)CC(=O)N1C |
| InChI | InChI=1S/C13H14BrN3O2S/c1-15-13-17(2)11(18)7-10(20-13)12(19)16-9-5-3-8(14)4-6-9/h3-6,10H,7H2,1-2H3,(H,16,19)/b15-13-/t10-/m0/s1 |
| InChIKey | CFINSZKPQOWFIU-ZSNVJIKNSA-N |
| XLogP | 2.34 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|