C18H14Cl3N3O3S — CID 1039360
(6R)-N-(4-chlorophenyl)-2-(3,5-dichloro-4-hydroxyphenyl)imino-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 1039360) has the molecular formula C18H14Cl3N3O3S and a molecular weight of 458.75 g/mol. Its IUPAC name is (6R)-N-(4-chlorophenyl)-2-(3,5-dichloro-4-hydroxyphenyl)imino-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (6R)-N-(4-chlorophenyl)-2-(3,5-dichloro-4-hydroxyphenyl)imino-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 1039360 |
| Molecular Formula | C18H14Cl3N3O3S |
| Molecular Weight | 458.75 g/mol |
| Exact Mass | 456.98 |
| IUPAC Name | (6R)-N-(4-chlorophenyl)-2-(3,5-dichloro-4-hydroxyphenyl)imino-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CN1C(=O)C[C@H](C(=O)Nc2ccc(Cl)cc2)S/C1=N\c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C18H14Cl3N3O3S/c1-24-15(25)8-14(17(27)22-10-4-2-9(19)3-5-10)28-18(24)23-11-6-12(20)16(26)13(21)7-11/h2-7,14,26H,8H2,1H3,(H,22,27)/b23-18-/t14-/m1/s1 |
| InChIKey | YSDZEXPRUNKPRT-ZYNBKEAPSA-N |
| XLogP | 4.94 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.75 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|