C19H15Cl2N3O4S — CID 1041612
4-[[(6R)-2-(2,5-dichlorophenyl)imino-3-methyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid (PubChem CID 1041612) has the molecular formula C19H15Cl2N3O4S and a molecular weight of 452.32 g/mol. Its IUPAC name is 4-[[(6R)-2-(2,5-dichlorophenyl)imino-3-methyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[(6R)-2-(2,5-dichlorophenyl)imino-3-methyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 1041612 |
| Molecular Formula | C19H15Cl2N3O4S |
| Molecular Weight | 452.32 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 4-[[(6R)-2-(2,5-dichlorophenyl)imino-3-methyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
| SMILES | CN1C(=O)C[C@H](C(=O)Nc2ccc(C(=O)O)cc2)S/C1=N\c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H15Cl2N3O4S/c1-24-16(25)9-15(17(26)22-12-5-2-10(3-6-12)18(27)28)29-19(24)23-14-8-11(20)4-7-13(14)21/h2-8,15H,9H2,1H3,(H,22,26)(H,27,28)/b23-19-/t15-/m1/s1 |
| InChIKey | ZSWVEOKFTBZKTA-GUYLDNPGSA-N |
| XLogP | 4.28 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|