C19H16Cl3N3O2S — CID 3352123
2-(3-chloro-4-methylphenyl)imino-N-(3,4-dichlorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 3352123) has the molecular formula C19H16Cl3N3O2S and a molecular weight of 456.78 g/mol. Its IUPAC name is 2-(3-chloro-4-methylphenyl)imino-N-(3,4-dichlorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(3-chloro-4-methylphenyl)imino-N-(3,4-dichlorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3352123 |
| Molecular Formula | C19H16Cl3N3O2S |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | 2-(3-chloro-4-methylphenyl)imino-N-(3,4-dichlorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | Cc1ccc(/N=C2\SC(C(=O)Nc3ccc(Cl)c(Cl)c3)CC(=O)N2C)cc1Cl |
| InChI | InChI=1S/C19H16Cl3N3O2S/c1-10-3-4-12(7-14(10)21)24-19-25(2)17(26)9-16(28-19)18(27)23-11-5-6-13(20)15(22)8-11/h3-8,16H,9H2,1-2H3,(H,23,27)/b24-19- |
| InChIKey | ZDTYQACEJHFEOD-CLCOLTQESA-N |
| XLogP | 5.55 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|