C19H15Cl2N3O4S — CID 5096365
2-(1,3-benzodioxol-5-ylimino)-N-(3,4-dichlorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 5096365) has the molecular formula C19H15Cl2N3O4S and a molecular weight of 452.32 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylimino)-N-(3,4-dichlorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylimino)-N-(3,4-dichlorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 5096365 |
| Molecular Formula | C19H15Cl2N3O4S |
| Molecular Weight | 452.32 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylimino)-N-(3,4-dichlorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CN1C(=O)CC(C(=O)Nc2ccc(Cl)c(Cl)c2)S/C1=N/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H15Cl2N3O4S/c1-24-17(25)8-16(18(26)22-10-2-4-12(20)13(21)6-10)29-19(24)23-11-3-5-14-15(7-11)28-9-27-14/h2-7,16H,8-9H2,1H3,(H,22,26)/b23-19+ |
| InChIKey | GTOCJHANZPUVCU-FCDQGJHFSA-N |
| XLogP | 4.31 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|