C20H18IN3O4S — CID 1038888
(6R)-2-(1,3-benzodioxol-5-ylimino)-3-ethyl-N-(4-iodophenyl)-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 1038888) has the molecular formula C20H18IN3O4S and a molecular weight of 523.35 g/mol. Its IUPAC name is (6R)-2-(1,3-benzodioxol-5-ylimino)-3-ethyl-N-(4-iodophenyl)-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (6R)-2-(1,3-benzodioxol-5-ylimino)-3-ethyl-N-(4-iodophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 1038888 |
| Molecular Formula | C20H18IN3O4S |
| Molecular Weight | 523.35 g/mol |
| Exact Mass | 523.01 |
| IUPAC Name | (6R)-2-(1,3-benzodioxol-5-ylimino)-3-ethyl-N-(4-iodophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCN1C(=O)C[C@H](C(=O)Nc2ccc(I)cc2)S/C1=N/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H18IN3O4S/c1-2-24-18(25)10-17(19(26)22-13-5-3-12(21)4-6-13)29-20(24)23-14-7-8-15-16(9-14)28-11-27-15/h3-9,17H,2,10-11H2,1H3,(H,22,26)/b23-20+/t17-/m1/s1 |
| InChIKey | KKLLGKQEXSOYID-LRWZUSMTSA-N |
| XLogP | 4.00 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|