C25H21N3O4S — CID 3139575
3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-N-phenyl-2-phenylimino-1,3-thiazinane-6-carboxamide (PubChem CID 3139575) has the molecular formula C25H21N3O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-N-phenyl-2-phenylimino-1,3-thiazinane-6-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-N-phenyl-2-phenylimino-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3139575 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-N-phenyl-2-phenylimino-1,3-thiazinane-6-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CC(=O)N(Cc2ccc3c(c2)OCO3)/C(=N/c2ccccc2)S1 |
| InChI | InChI=1S/C25H21N3O4S/c29-23-14-22(24(30)26-18-7-3-1-4-8-18)33-25(27-19-9-5-2-6-10-19)28(23)15-17-11-12-20-21(13-17)32-16-31-20/h1-13,22H,14-16H2,(H,26,30)/b27-25- |
| InChIKey | YVNIQSQLHFVMBN-RFBIWTDZSA-N |
| XLogP | 4.58 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|