C26H20FN3O6S — CID 98121511
4-[[(6S)-3-(1,3-benzodioxol-5-ylmethyl)-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid (PubChem CID 98121511) has the molecular formula C26H20FN3O6S and a molecular weight of 521.53 g/mol. Its IUPAC name is 4-[[(6S)-3-(1,3-benzodioxol-5-ylmethyl)-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[(6S)-3-(1,3-benzodioxol-5-ylmethyl)-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 98121511 |
| Molecular Formula | C26H20FN3O6S |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 4-[[(6S)-3-(1,3-benzodioxol-5-ylmethyl)-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)[C@@H]2CC(=O)N(Cc3ccc4c(c3)OCO4)/C(=N/c3ccc(F)cc3)S2)cc1 |
| InChI | InChI=1S/C26H20FN3O6S/c27-17-4-8-19(9-5-17)29-26-30(13-15-1-10-20-21(11-15)36-14-35-20)23(31)12-22(37-26)24(32)28-18-6-2-16(3-7-18)25(33)34/h1-11,22H,12-14H2,(H,28,32)(H,33,34)/b29-26-/t22-/m0/s1 |
| InChIKey | MLAMKBKINDDSBJ-RPHWMWBOSA-N |
| XLogP | 4.41 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|