C27H22ClN3O6S — CID 5078388
methyl 4-[[3-(1,3-benzodioxol-5-ylmethyl)-2-(3-chlorophenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate (PubChem CID 5078388) has the molecular formula C27H22ClN3O6S and a molecular weight of 552.01 g/mol. Its IUPAC name is methyl 4-[[3-(1,3-benzodioxol-5-ylmethyl)-2-(3-chlorophenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[3-(1,3-benzodioxol-5-ylmethyl)-2-(3-chlorophenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 5078388 |
| Molecular Formula | C27H22ClN3O6S |
| Molecular Weight | 552.01 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | methyl 4-[[3-(1,3-benzodioxol-5-ylmethyl)-2-(3-chlorophenyl)imino-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2CC(=O)N(Cc3ccc4c(c3)OCO4)/C(=N/c3cccc(Cl)c3)S2)cc1 |
| InChI | InChI=1S/C27H22ClN3O6S/c1-35-26(34)17-6-8-19(9-7-17)29-25(33)23-13-24(32)31(14-16-5-10-21-22(11-16)37-15-36-21)27(38-23)30-20-4-2-3-18(28)12-20/h2-12,23H,13-15H2,1H3,(H,29,33)/b30-27- |
| InChIKey | FFBJDJHHFOPGSD-IKPAITLHSA-N |
| XLogP | 5.02 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.01 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|