C27H24ClN3O5S — CID 5078387
3-(1,3-benzodioxol-5-ylmethyl)-2-(3-chlorophenyl)imino-N-(3-ethoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 5078387) has the molecular formula C27H24ClN3O5S and a molecular weight of 538.03 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-2-(3-chlorophenyl)imino-N-(3-ethoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-2-(3-chlorophenyl)imino-N-(3-ethoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 5078387 |
| Molecular Formula | C27H24ClN3O5S |
| Molecular Weight | 538.03 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-2-(3-chlorophenyl)imino-N-(3-ethoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCOc1cccc(NC(=O)C2CC(=O)N(Cc3ccc4c(c3)OCO4)/C(=N/c3cccc(Cl)c3)S2)c1 |
| InChI | InChI=1S/C27H24ClN3O5S/c1-2-34-21-8-4-7-20(13-21)29-26(33)24-14-25(32)31(15-17-9-10-22-23(11-17)36-16-35-22)27(37-24)30-19-6-3-5-18(28)12-19/h3-13,24H,2,14-16H2,1H3,(H,29,33)/b30-27- |
| InChIKey | KNIYXIXSWCJOMB-IKPAITLHSA-N |
| XLogP | 5.63 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.03 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|