C20H17Cl2N3O5S — CID 1114434
methyl 4-[[(6R)-2-(3,5-dichloro-4-hydroxyphenyl)imino-3-methyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate (PubChem CID 1114434) has the molecular formula C20H17Cl2N3O5S and a molecular weight of 482.35 g/mol. Its IUPAC name is methyl 4-[[(6R)-2-(3,5-dichloro-4-hydroxyphenyl)imino-3-methyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[(6R)-2-(3,5-dichloro-4-hydroxyphenyl)imino-3-methyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 1114434 |
| Molecular Formula | C20H17Cl2N3O5S |
| Molecular Weight | 482.35 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | methyl 4-[[(6R)-2-(3,5-dichloro-4-hydroxyphenyl)imino-3-methyl-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)[C@H]2CC(=O)N(C)/C(=N/c3cc(Cl)c(O)c(Cl)c3)S2)cc1 |
| InChI | InChI=1S/C20H17Cl2N3O5S/c1-25-16(26)9-15(18(28)23-11-5-3-10(4-6-11)19(29)30-2)31-20(25)24-12-7-13(21)17(27)14(22)8-12/h3-8,15,27H,9H2,1-2H3,(H,23,28)/b24-20-/t15-/m1/s1 |
| InChIKey | OPUIPQPAYAOJIT-SXDATVTGSA-N |
| XLogP | 4.08 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|