C20H19Cl2N3O4S — CID 4057517
2-(3,5-dichloro-4-hydroxyphenyl)imino-N-(4-ethoxyphenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 4057517) has the molecular formula C20H19Cl2N3O4S and a molecular weight of 468.36 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-hydroxyphenyl)imino-N-(4-ethoxyphenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(3,5-dichloro-4-hydroxyphenyl)imino-N-(4-ethoxyphenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4057517 |
| Molecular Formula | C20H19Cl2N3O4S |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 2-(3,5-dichloro-4-hydroxyphenyl)imino-N-(4-ethoxyphenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2CC(=O)N(C)/C(=N/c3cc(Cl)c(O)c(Cl)c3)S2)cc1 |
| InChI | InChI=1S/C20H19Cl2N3O4S/c1-3-29-13-6-4-11(5-7-13)23-19(28)16-10-17(26)25(2)20(30-16)24-12-8-14(21)18(27)15(22)9-12/h4-9,16,27H,3,10H2,1-2H3,(H,23,28)/b24-20- |
| InChIKey | NXVNXNXWJFLICF-GFMRDNFCSA-N |
| XLogP | 4.69 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|