C23H27N3O3S — CID 3762773
2-(3,4-dimethylphenyl)imino-3-methyl-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide (PubChem CID 3762773) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)imino-3-methyl-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(3,4-dimethylphenyl)imino-3-methyl-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3762773 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-(3,4-dimethylphenyl)imino-3-methyl-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)C2CC(=O)N(C)/C(=N/c3ccc(C)c(C)c3)S2)cc1 |
| InChI | InChI=1S/C23H27N3O3S/c1-5-12-29-19-10-8-17(9-11-19)24-22(28)20-14-21(27)26(4)23(30-20)25-18-7-6-15(2)16(3)13-18/h6-11,13,20H,5,12,14H2,1-4H3,(H,24,28)/b25-23- |
| InChIKey | UAARFLVRIFKWRS-BZZOAKBMSA-N |
| XLogP | 4.68 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|