C21H20ClF2N3O4S — CID 4031930
2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(3-ethoxyphenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 4031930) has the molecular formula C21H20ClF2N3O4S and a molecular weight of 483.92 g/mol. Its IUPAC name is 2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(3-ethoxyphenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(3-ethoxyphenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4031930 |
| Molecular Formula | C21H20ClF2N3O4S |
| Molecular Weight | 483.92 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(3-ethoxyphenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCOc1cccc(NC(=O)C2CC(=O)N(C)/C(=N/c3ccc(OC(F)(F)Cl)cc3)S2)c1 |
| InChI | InChI=1S/C21H20ClF2N3O4S/c1-3-30-16-6-4-5-14(11-16)25-19(29)17-12-18(28)27(2)20(32-17)26-13-7-9-15(10-8-13)31-21(22,23)24/h4-11,17H,3,12H2,1-2H3,(H,25,29)/b26-20- |
| InChIKey | HDDNSIPTKYGYDV-QOMWVZHYSA-N |
| XLogP | 4.84 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.92 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|