C19H15Cl2F2N3O3S — CID 1043728
(6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(2-chlorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 1043728) has the molecular formula C19H15Cl2F2N3O3S and a molecular weight of 474.32 g/mol. Its IUPAC name is (6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(2-chlorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(2-chlorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 1043728 |
| Molecular Formula | C19H15Cl2F2N3O3S |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | (6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(2-chlorophenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CN1C(=O)C[C@@H](C(=O)Nc2ccccc2Cl)S/C1=N\c1ccc(OC(F)(F)Cl)cc1 |
| InChI | InChI=1S/C19H15Cl2F2N3O3S/c1-26-16(27)10-15(17(28)25-14-5-3-2-4-13(14)20)30-18(26)24-11-6-8-12(9-7-11)29-19(21,22)23/h2-9,15H,10H2,1H3,(H,25,28)/b24-18-/t15-/m0/s1 |
| InChIKey | GLSNEHYQXLALIE-BHQWEUPHSA-N |
| XLogP | 5.10 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|