C27H23Cl2F2N3O3S — CID 98056794
(6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(3-chloro-4-methylphenyl)-4-oxo-3-(2-phenylethyl)-1,3-thiazinane-6-carboxamide (PubChem CID 98056794) has the molecular formula C27H23Cl2F2N3O3S and a molecular weight of 578.47 g/mol. Its IUPAC name is (6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(3-chloro-4-methylphenyl)-4-oxo-3-(2-phenylethyl)-1,3-thiazinane-6-carboxamide.
| Compound Name | (6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(3-chloro-4-methylphenyl)-4-oxo-3-(2-phenylethyl)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 98056794 |
| Molecular Formula | C27H23Cl2F2N3O3S |
| Molecular Weight | 578.47 g/mol |
| Exact Mass | 577.08 |
| IUPAC Name | (6S)-2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(3-chloro-4-methylphenyl)-4-oxo-3-(2-phenylethyl)-1,3-thiazinane-6-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CC(=O)N(CCc3ccccc3)/C(=N/c3ccc(OC(F)(F)Cl)cc3)S2)cc1Cl |
| InChI | InChI=1S/C27H23Cl2F2N3O3S/c1-17-7-8-20(15-22(17)28)32-25(36)23-16-24(35)34(14-13-18-5-3-2-4-6-18)26(38-23)33-19-9-11-21(12-10-19)37-27(29,30)31/h2-12,15,23H,13-14,16H2,1H3,(H,32,36)/b33-26-/t23-/m0/s1 |
| InChIKey | XPXPMFRJNYLRQX-AIAZDZNISA-N |
| XLogP | 7.02 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.47 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|