C20H17ClF2N2O4S — CID 5113793
2-[4-[chloro(difluoro)methoxy]phenyl]imino-4-oxo-3-(2-phenylethyl)-1,3-thiazinane-6-carboxylic acid (PubChem CID 5113793) has the molecular formula C20H17ClF2N2O4S and a molecular weight of 454.88 g/mol. Its IUPAC name is 2-[4-[chloro(difluoro)methoxy]phenyl]imino-4-oxo-3-(2-phenylethyl)-1,3-thiazinane-6-carboxylic acid.
| Compound Name | 2-[4-[chloro(difluoro)methoxy]phenyl]imino-4-oxo-3-(2-phenylethyl)-1,3-thiazinane-6-carboxylic acid |
|---|---|
| PubChem CID | 5113793 |
| Molecular Formula | C20H17ClF2N2O4S |
| Molecular Weight | 454.88 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 2-[4-[chloro(difluoro)methoxy]phenyl]imino-4-oxo-3-(2-phenylethyl)-1,3-thiazinane-6-carboxylic acid |
| SMILES | O=C(O)C1CC(=O)N(CCc2ccccc2)/C(=N/c2ccc(OC(F)(F)Cl)cc2)S1 |
| InChI | InChI=1S/C20H17ClF2N2O4S/c21-20(22,23)29-15-8-6-14(7-9-15)24-19-25(11-10-13-4-2-1-3-5-13)17(26)12-16(30-19)18(27)28/h1-9,16H,10-12H2,(H,27,28)/b24-19- |
| InChIKey | DWIUVBLOFFSPBB-CLCOLTQESA-N |
| XLogP | 4.50 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.88 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|