C19H15ClF2N2O4S — CID 1239656
(6S)-3-benzyl-2-[4-[chloro(difluoro)methoxy]phenyl]imino-4-oxo-1,3-thiazinane-6-carboxylic acid (PubChem CID 1239656) has the molecular formula C19H15ClF2N2O4S and a molecular weight of 440.86 g/mol. Its IUPAC name is (6S)-3-benzyl-2-[4-[chloro(difluoro)methoxy]phenyl]imino-4-oxo-1,3-thiazinane-6-carboxylic acid.
| Compound Name | (6S)-3-benzyl-2-[4-[chloro(difluoro)methoxy]phenyl]imino-4-oxo-1,3-thiazinane-6-carboxylic acid |
|---|---|
| PubChem CID | 1239656 |
| Molecular Formula | C19H15ClF2N2O4S |
| Molecular Weight | 440.86 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | (6S)-3-benzyl-2-[4-[chloro(difluoro)methoxy]phenyl]imino-4-oxo-1,3-thiazinane-6-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC(=O)N(Cc2ccccc2)/C(=N/c2ccc(OC(F)(F)Cl)cc2)S1 |
| InChI | InChI=1S/C19H15ClF2N2O4S/c20-19(21,22)28-14-8-6-13(7-9-14)23-18-24(11-12-4-2-1-3-5-12)16(25)10-15(29-18)17(26)27/h1-9,15H,10-11H2,(H,26,27)/b23-18-/t15-/m0/s1 |
| InChIKey | BWTNYAHKVFPNFC-ACNSNUFOSA-N |
| XLogP | 4.46 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.86 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|