C28H29N3O4S — CID 5060945
2-(4-methoxyphenyl)imino-3-[(4-methoxyphenyl)methyl]-4-oxo-N-(2-phenylethyl)-1,3-thiazinane-6-carboxamide (PubChem CID 5060945) has the molecular formula C28H29N3O4S and a molecular weight of 503.62 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)imino-3-[(4-methoxyphenyl)methyl]-4-oxo-N-(2-phenylethyl)-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(4-methoxyphenyl)imino-3-[(4-methoxyphenyl)methyl]-4-oxo-N-(2-phenylethyl)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 5060945 |
| Molecular Formula | C28H29N3O4S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 2-(4-methoxyphenyl)imino-3-[(4-methoxyphenyl)methyl]-4-oxo-N-(2-phenylethyl)-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(CN2C(=O)CC(C(=O)NCCc3ccccc3)S/C2=N\c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H29N3O4S/c1-34-23-12-8-21(9-13-23)19-31-26(32)18-25(27(33)29-17-16-20-6-4-3-5-7-20)36-28(31)30-22-10-14-24(35-2)15-11-22/h3-15,25H,16-19H2,1-2H3,(H,29,33)/b30-28- |
| InChIKey | OFXGKBADQCJVPB-HYOGKJQXSA-N |
| XLogP | 4.58 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|