C26H23ClFN3O2S — CID 4277202
2-(4-chlorophenyl)imino-3-[(4-fluorophenyl)methyl]-4-oxo-N-(2-phenylethyl)-1,3-thiazinane-6-carboxamide (PubChem CID 4277202) has the molecular formula C26H23ClFN3O2S and a molecular weight of 496.01 g/mol. Its IUPAC name is 2-(4-chlorophenyl)imino-3-[(4-fluorophenyl)methyl]-4-oxo-N-(2-phenylethyl)-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(4-chlorophenyl)imino-3-[(4-fluorophenyl)methyl]-4-oxo-N-(2-phenylethyl)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4277202 |
| Molecular Formula | C26H23ClFN3O2S |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 2-(4-chlorophenyl)imino-3-[(4-fluorophenyl)methyl]-4-oxo-N-(2-phenylethyl)-1,3-thiazinane-6-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C1CC(=O)N(Cc2ccc(F)cc2)/C(=N/c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C26H23ClFN3O2S/c27-20-8-12-22(13-9-20)30-26-31(17-19-6-10-21(28)11-7-19)24(32)16-23(34-26)25(33)29-15-14-18-4-2-1-3-5-18/h1-13,23H,14-17H2,(H,29,33)/b30-26- |
| InChIKey | NFBLEGIJSSJBSK-BXVZCJGGSA-N |
| XLogP | 5.36 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|