C20H19ClFN3O2S — CID 3587259
2-(3-chlorophenyl)imino-N-ethyl-3-[(4-fluorophenyl)methyl]-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 3587259) has the molecular formula C20H19ClFN3O2S and a molecular weight of 419.91 g/mol. Its IUPAC name is 2-(3-chlorophenyl)imino-N-ethyl-3-[(4-fluorophenyl)methyl]-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(3-chlorophenyl)imino-N-ethyl-3-[(4-fluorophenyl)methyl]-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3587259 |
| Molecular Formula | C20H19ClFN3O2S |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2-(3-chlorophenyl)imino-N-ethyl-3-[(4-fluorophenyl)methyl]-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCNC(=O)C1CC(=O)N(Cc2ccc(F)cc2)/C(=N/c2cccc(Cl)c2)S1 |
| InChI | InChI=1S/C20H19ClFN3O2S/c1-2-23-19(27)17-11-18(26)25(12-13-6-8-15(22)9-7-13)20(28-17)24-16-5-3-4-14(21)10-16/h3-10,17H,2,11-12H2,1H3,(H,23,27)/b24-20- |
| InChIKey | VCBGJOKBOCWOKT-GFMRDNFCSA-N |
| XLogP | 4.14 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|