C25H21ClFN3O3S — CID 41201221
(6R)-N-(3-chlorophenyl)-2-(4-fluorophenyl)imino-3-[(4-methoxyphenyl)methyl]-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 41201221) has the molecular formula C25H21ClFN3O3S and a molecular weight of 497.98 g/mol. Its IUPAC name is (6R)-N-(3-chlorophenyl)-2-(4-fluorophenyl)imino-3-[(4-methoxyphenyl)methyl]-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (6R)-N-(3-chlorophenyl)-2-(4-fluorophenyl)imino-3-[(4-methoxyphenyl)methyl]-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 41201221 |
| Molecular Formula | C25H21ClFN3O3S |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | (6R)-N-(3-chlorophenyl)-2-(4-fluorophenyl)imino-3-[(4-methoxyphenyl)methyl]-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(CN2C(=O)C[C@H](C(=O)Nc3cccc(Cl)c3)S/C2=N\c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H21ClFN3O3S/c1-33-21-11-5-16(6-12-21)15-30-23(31)14-22(24(32)28-20-4-2-3-17(26)13-20)34-25(30)29-19-9-7-18(27)8-10-19/h2-13,22H,14-15H2,1H3,(H,28,32)/b29-25-/t22-/m1/s1 |
| InChIKey | WCISSJOZUKSJDH-YRUIYKTESA-N |
| XLogP | 5.65 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|